Systematic / IUPAC Name: 3-Carboxy-2-(hexanoyloxy)-N,N,N-trimethyl-1-propanaminium
ID: Reference883
Other Names:
3-(Hexanoyloxy)-4-(trimethylammonio)butanoate;
Hexanoyl DL-carnitine
Formula: C13H26NO4 +
Class: Endogenous Metabolites
Hexanoylcarnitine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 126 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/24/2015 10:01:29 AM |
| InChI | InChI=1S/C13H25NO4/c1-5-6-7-8-13(17)18-11(9-12(15)16)10-14(2,3)4/h11H,5-10H2,1-4H3 |
| InChI Key | VVPRQWTYSNDTEA-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCC(=O)OC(CC(=O)[O-])C[N+](C)(C)C |
| CAS | 14919347 |
| Splash | |
| Other Names |
3-(Hexanoyloxy)-4-(trimethylammonio)butanoate; Hexanoyl DL-carnitine |
| HMDb | HMDB00705 |
| ChEBI | CHEBI:70749 |
| ChemSpider | 2339561 |
| PubChem | 6426853 |