Systematic / IUPAC Name: 1-[(3S,3aR,6S,6aR)-6-(5-Phenoxytetrazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-phenylurea
ID: Reference8839
Other Names:
L-Iditol, 1,4:3,6-dianhydro-2,5-dideoxy-2-(5-phenoxy-1H-tetrazol-1-yl)-5-[[(phenylamino)carbonyl]amino]-;
NAT6-298130
Formula: C20H20N6O4
1,4:3,6-Dianhydro-2,5-dideoxy-2-(5-phenoxy-1H-tetrazol-1-yl)-5-[(phenylcarbamoyl)amino]-L-iditol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 3553 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/12/2019 7:09:36 AM |
| InChI | InChI=1S/C20H20N6O4/c27-19(21-13-7-3-1-4-8-13)22-15-11-28-18-16(12-29-17(15)18)26-20(23-24-25-26)30-14-9-5-2-6-10-14/h1-10,15-18H,11-12H2,(H2,21,22,27)/t15-,16-,17+,18+/m0/s1 |
| InChI Key | CZFPUTCPJIQPPD-WNRNVDISSA-N |
| Canonical SMILES | C1C(C2C(O1)C(CO2)N3C(=NN=N3)OC4=CC=CC=C4)NC(=O)NC5=CC=CC=C5 |
| CAS | |
| Splash | |
| Other Names |
L-Iditol, 1,4:3,6-dianhydro-2,5-dideoxy-2-(5-phenoxy-1H-tetrazol-1-yl)-5-[[(phenylamino)carbonyl]amino]-; NAT6-298130 |