Systematic / IUPAC Name: 1-[(1R,9S)-11-Acetyl-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-5-yl]-3-phenylurea
ID: Reference8854
Other Names:
Urea, N-[(1R,5S)-3-acetyl-1,3,4,5,6,8-hexahydro-8-oxo-1,5-methano-2H-pyrido[1,2-a][1,5]diazocin-9-yl]-N'-phenyl-;
NAT11-291975
Formula: C20H22N4O3
1-[(1R,9S)-11-Acetyl-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-5-yl]-3-phenylurea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2452 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6, MS7, MS8 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/2/2024 8:13:41 AM |
| InChI | InChI=1S/C20H22N4O3/c1-13(25)23-10-14-9-15(12-23)18-8-7-17(19(26)24(18)11-14)22-20(27)21-16-5-3-2-4-6-16/h2-8,14-15H,9-12H2,1H3,(H2,21,22,27)/t14-,15+/m0/s1 |
| InChI Key | JQNHYJIRYHWBAO-LSDHHAIUSA-N |
| Canonical SMILES | CC(=O)N1CC2CC(C1)C3=CC=C(C(=O)N3C2)NC(=O)NC4=CC=CC=C4 |
| CAS | |
| Splash | |
| Other Names |
Urea, N-[(1R,5S)-3-acetyl-1,3,4,5,6,8-hexahydro-8-oxo-1,5-methano-2H-pyrido[1,2-a][1,5]diazocin-9-yl]-N'-phenyl-; NAT11-291975 |