Systematic / IUPAC Name: N-[[(2R,4S,5S)-5-Ethynyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]furan-2-carboxamide
ID: Reference8889
Other Names:
2-Furancarboxamide, N-[[(2R,4S,5S)-5-ethynyl-1-azabicyclo[2.2.2]oct-2-yl]methyl]-;
NAT13-337568
Formula: C15H18N2O2
N-{[(2R,4S,5S)-5-Ethynyl-1-azabicyclo[2.2.2]oct-2-yl]methyl}-2-furamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 560 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/9/2019 6:11:05 AM |
| InChI | InChI=1S/C15H18N2O2/c1-2-11-10-17-6-5-12(11)8-13(17)9-16-15(18)14-4-3-7-19-14/h1,3-4,7,11-13H,5-6,8-10H2,(H,16,18)/t11-,12-,13+/m0/s1 |
| InChI Key | QZOWFPRRCLIBFP-RWMBFGLXSA-N |
| Canonical SMILES | C#CC1CN2CCC1CC2CNC(=O)C3=CC=CO3 |
| CAS | |
| Splash | |
| Other Names |
2-Furancarboxamide, N-[[(2R,4S,5S)-5-ethynyl-1-azabicyclo[2.2.2]oct-2-yl]methyl]-; NAT13-337568 |