Systematic / IUPAC Name: N-[[(2R,4S,5R)-5-Ethyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]furan-2-carboxamide
ID: Reference8890
Other Names:
2-Furancarboxamide, N-[[(2R,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]oct-2-yl]methyl]-;
NAT13-337362
Formula: C15H22N2O2
N-{[(2R,4S,5R)-5-Ethyl-1-azabicyclo[2.2.2]oct-2-yl]methyl}-2-furamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 829 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/9/2019 6:15:08 AM |
| InChI | InChI=1S/C15H22N2O2/c1-2-11-10-17-6-5-12(11)8-13(17)9-16-15(18)14-4-3-7-19-14/h3-4,7,11-13H,2,5-6,8-10H2,1H3,(H,16,18)/t11-,12-,13+/m0/s1 |
| InChI Key | KYWNQBTVUAVAGP-RWMBFGLXSA-N |
| Canonical SMILES | CCC1CN2CCC1CC2CNC(=O)C3=CC=CO3 |
| CAS | |
| Splash | |
| Other Names |
2-Furancarboxamide, N-[[(2R,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]oct-2-yl]methyl]-; NAT13-337362 |
| ChEMBL | CHEMBL3437415 |
| ChemSpider | 10117597 |
| PubChem | 11943278 |