Systematic / IUPAC Name: 1-[[(2R,4S,5R)-5-Ethyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3-[3-(trifluoromethyl)phenyl]urea
ID: Reference8893
Other Names:
Urea, N-[[(2R,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]oct-2-yl]methyl]-N'-[3-(trifluoromethyl)phenyl]-;
NAT13-337393
Formula: C18H24F3N3O
1-{[(2R,4S,5R)-5-Ethyl-1-azabicyclo[2.2.2]oct-2-yl]methyl}-3-[3-(trifluoromethyl)phenyl]urea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 914 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/9/2019 6:25:01 AM |
| InChI | InChI=1S/C18H24F3N3O/c1-2-12-11-24-7-6-13(12)8-16(24)10-22-17(25)23-15-5-3-4-14(9-15)18(19,20)21/h3-5,9,12-13,16H,2,6-8,10-11H2,1H3,(H2,22,23,25)/t12-,13-,16+/m0/s1 |
| InChI Key | HWKAXYWOANYZSR-HEHGZKQESA-N |
| Canonical SMILES | CCC1CN2CCC1CC2CNC(=O)NC3=CC=CC(=C3)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names |
Urea, N-[[(2R,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]oct-2-yl]methyl]-N'-[3-(trifluoromethyl)phenyl]-; NAT13-337393 |
| ChemSpider | 10117627 |
| ChEMBL | CHEMBL3437416 |
| PubChem | 11943308 |