Systematic / IUPAC Name: 3,6-Bis(diethylamino)xanthenium
ID: Reference890
Other Names:
Ethanaminium, N-(6-(diethylamino)-3H-xanthen-3-ylidene)-N-ethyl-;
Xanthylium, 3,6-bis(diethylamino)-;
Pyronin B
Formula: C21H27N2O+
Class: Industrial Chemicals
Pyronine B mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 71 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/25/2015 8:03:02 AM |
| InChI | InChI=1S/C21H27N2O/c1-5-22(6-2)18-11-9-16-13-17-10-12-19(23(7-3)8-4)15-21(17)24-20(16)14-18/h9-15H,5-8H2,1-4H3/q+1 |
| InChI Key | BIOUTGSRJYRPFT-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | 2150483 |
| Splash | |
| Other Names |
Ethanaminium, N-(6-(diethylamino)-3H-xanthen-3-ylidene)-N-ethyl-; Xanthylium, 3,6-bis(diethylamino)-; Pyronin B |
| PubChem | 16525 |
| ChEMBL | CHEMBL2010313 |
| ChemIDPlus | 062669696 |
| ChemSpider | 15665 |