Systematic / IUPAC Name: 2-(2,3-Dimethylphenyl)-8-methoxy-6a,7,8,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione
ID: Reference8923
Other Names:
1H-Pyrrolo[2,1-c][1,4]benzodiazepine-5,11(10H,11aH)-dione, 7-(2,3-dimethylphenyl)-2,3-dihydro-2-methoxy-;
NAT3-198211
Formula: C21H22N2O3
7-(2,3-Dimethylphenyl)-2-methoxy-2,3-dihydro-1H-pyrrolo[2,1-c][1,4]benzodiazepine-5,11(10H,11aH)-dione mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1128 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/13/2019 10:56:38 AM |
| InChI | InChI=1S/C21H22N2O3/c1-12-5-4-6-16(13(12)2)14-7-8-18-17(9-14)21(25)23-11-15(26-3)10-19(23)20(24)22-18/h4-9,15,19H,10-11H2,1-3H3,(H,22,24) |
| InChI Key | XRDFSMCKQGQSQO-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C(=CC=C1)C2=CC3=C(C=C2)NC(=O)C4CC(CN4C3=O)OC)C |
| CAS | |
| Splash | |
| Other Names |
1H-Pyrrolo[2,1-c][1,4]benzodiazepine-5,11(10H,11aH)-dione, 7-(2,3-dimethylphenyl)-2,3-dihydro-2-methoxy-; NAT3-198211 |