Systematic / IUPAC Name: Methyl 1-[(3S,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]triazole-4-carboxylate
ID: Reference8976
Other Names:
D-Glucitol, 1,4:3,6-dianhydro-2-deoxy-2-[4-(methoxycarbonyl)-1H-1,2,3-triazol-1-yl]-;
NAT6-305167
Formula: C10H13N3O5
1,4:3,6-Dianhydro-2-deoxy-2-[4-(methoxycarbonyl)-1H-1,2,3-triazol-1-yl]-D-glucitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 663 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/14/2019 11:14:04 AM |
| InChI | InChI=1S/C10H13N3O5/c1-16-10(15)5-2-13(12-11-5)6-3-17-9-7(14)4-18-8(6)9/h2,6-9,14H,3-4H2,1H3/t6-,7+,8+,9+/m0/s1 |
| InChI Key | ZHZSGODANHLOGP-JQCXWYLXSA-N |
| Canonical SMILES | COC(=O)C1=CN(N=N1)C2COC3C2OCC3O |
| CAS | |
| Splash | |
| Other Names |
D-Glucitol, 1,4:3,6-dianhydro-2-deoxy-2-[4-(methoxycarbonyl)-1H-1,2,3-triazol-1-yl]-; NAT6-305167 |