Systematic / IUPAC Name: N-[[(2R,4S,5R)-5-(2-Methyl-5-naphthalen-2-ylpyrazol-3-yl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]methanesulfonamide
ID: Reference8980
Other Names:
Methanesulfonamide, N-[[(2R,4S,5R)-5-[1-methyl-3-(2-naphthalenyl)-1H-pyrazol-5-yl]-1-azabicyclo[2.2.2]oct-2-yl]methyl]-;
NAT13-338109
Formula: C23H28N4O2S
N-({(2R,4S,5R)-5-[1-Methyl-3-(2-naphthyl)-1H-pyrazol-5-yl]-1-azabicyclo[2.2.2]oct-2-yl}methyl)methanesulfonamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2064 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/2/2024 11:08:54 AM |
| InChI | InChI=1S/C23H28N4O2S/c1-26-23(13-22(25-26)19-8-7-16-5-3-4-6-17(16)11-19)21-15-27-10-9-18(21)12-20(27)14-24-30(2,28)29/h3-8,11,13,18,20-21,24H,9-10,12,14-15H2,1-2H3/t18-,20+,21-/m0/s1 |
| InChI Key | CJXGXLQJTJBLCI-TYPHKJRUSA-N |
| Canonical SMILES | CN1C(=CC(=N1)C2=CC3=CC=CC=C3C=C2)C4CN5CCC4CC5CNS(=O)(=O)C |
| CAS | |
| Splash | |
| Other Names |
Methanesulfonamide, N-[[(2R,4S,5R)-5-[1-methyl-3-(2-naphthalenyl)-1H-pyrazol-5-yl]-1-azabicyclo[2.2.2]oct-2-yl]methyl]-; NAT13-338109 |