Systematic / IUPAC Name: N-[(3S,3aR,6S,6aR)-6-[4-(Cyclohexylmethyl)triazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-4-(dimethylamino)benzamide
ID: Reference8982
Other Names:
L-Iditol, 1,4:3,6-dianhydro-2-[4-(cyclohexylmethyl)-1H-1,2,3-triazol-1-yl]-2,5-dideoxy-5-[[4-(dimethylamino)benzoyl]amino]-;
NAT6-306452
Formula: C24H33N5O3
1,4:3,6-Dianhydro-2-[4-(cyclohexylmethyl)-1H-1,2,3-triazol-1-yl]-2,5-dideoxy-5-{[4-(dimethylamino)benzoyl]amino}-L-iditol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 3317 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/14/2019 11:44:26 AM |
| InChI | InChI=1S/C24H33N5O3/c1-28(2)19-10-8-17(9-11-19)24(30)25-20-14-31-23-21(15-32-22(20)23)29-13-18(26-27-29)12-16-6-4-3-5-7-16/h8-11,13,16,20-23H,3-7,12,14-15H2,1-2H3,(H,25,30)/t20-,21-,22+,23+/m0/s1 |
| InChI Key | SPBFXHGEPVLXLC-MYDTUXCISA-N |
| Canonical SMILES | CN(C)C1=CC=C(C=C1)C(=O)NC2COC3C2OCC3N4C=C(N=N4)CC5CCCCC5 |
| CAS | |
| Splash | |
| Other Names |
L-Iditol, 1,4:3,6-dianhydro-2-[4-(cyclohexylmethyl)-1H-1,2,3-triazol-1-yl]-2,5-dideoxy-5-[[4-(dimethylamino)benzoyl]amino]-; NAT6-306452 |