Systematic / IUPAC Name: N-[(3S,3aR,6S,6aR)-3-[[4-(3-Fluorophenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-2-methoxyacetamide
ID: Reference8986
Other Names:
L-Iditol, 1,4:3,6-dianhydro-2,5-dideoxy-2-[[4-(3-fluorophenyl)-2-pyrimidinyl]amino]-5-[(2-methoxyacetyl)amino]-;
NAT6-324252
Formula: C19H21FN4O4
1,4:3,6-Dianhydro-2,5-dideoxy-2-{[4-(3-fluorophenyl)-2-pyrimidinyl]amino}-5-[(methoxyacetyl)amino]-L-iditol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 3475 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/10/2019 11:34:22 AM |
| InChI | InChI=1S/C19H21FN4O4/c1-26-10-16(25)22-14-8-27-18-15(9-28-17(14)18)24-19-21-6-5-13(23-19)11-3-2-4-12(20)7-11/h2-7,14-15,17-18H,8-10H2,1H3,(H,22,25)(H,21,23,24)/t14-,15-,17+,18+/m0/s1 |
| InChI Key | LFACFSSFPGPXLQ-CWLKWCNXSA-N |
| Canonical SMILES | COCC(=O)NC1COC2C1OCC2NC3=NC=CC(=N3)C4=CC(=CC=C4)F |
| CAS | |
| Splash | |
| Other Names |
L-Iditol, 1,4:3,6-dianhydro-2,5-dideoxy-2-[[4-(3-fluorophenyl)-2-pyrimidinyl]amino]-5-[(2-methoxyacetyl)amino]-; NAT6-324252 |