Systematic / IUPAC Name: 1-[(3S,3aR,6S,6aR)-3-[[4-(3-Fluorophenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-3-prop-2-enylurea
ID: Reference8995
Other Names:
L-Iditol, 1,4:3,6-dianhydro-2,5-dideoxy-2-[[4-(3-fluorophenyl)-2-pyrimidinyl]amino]-5-[[(2-propen-1-ylamino)carbonyl]amino]-;
NAT6-324286
Formula: C20H22FN5O3
2-[(Allylcarbamoyl)amino]-1,4:3,6-dianhydro-2,5-dideoxy-5-{[4-(3-fluorophenyl)-2-pyrimidinyl]amino}-L-iditol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 4646 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/10/2019 12:09:06 PM |
| InChI | InChI=1S/C20H22FN5O3/c1-2-7-23-20(27)26-16-11-29-17-15(10-28-18(16)17)25-19-22-8-6-14(24-19)12-4-3-5-13(21)9-12/h2-6,8-9,15-18H,1,7,10-11H2,(H,22,24,25)(H2,23,26,27)/t15-,16-,17+,18+/m0/s1 |
| InChI Key | YIFHFKJPWYIHEP-WNRNVDISSA-N |
| Canonical SMILES | C=CCNC(=O)NC1COC2C1OCC2NC3=NC=CC(=N3)C4=CC(=CC=C4)F |
| CAS | |
| Splash | |
| Other Names |
L-Iditol, 1,4:3,6-dianhydro-2,5-dideoxy-2-[[4-(3-fluorophenyl)-2-pyrimidinyl]amino]-5-[[(2-propen-1-ylamino)carbonyl]amino]-; NAT6-324286 |