Systematic / IUPAC Name: N-[[(2R,4S,5R)-5-Ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3,3-dimethylbutanamide
ID: Reference9006
Other Names:
Butanamide, N-[[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]oct-2-yl]methyl]-3,3-dimethyl-;
NAT13-337457
Formula: C16H28N2O
3,3-Dimethyl-N-{[(2R,4S,5R)-5-vinyl-1-azabicyclo[2.2.2]oct-2-yl]methyl}butanamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 475 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/21/2019 6:23:10 AM |
| InChI | InChI=1S/C16H28N2O/c1-5-12-11-18-7-6-13(12)8-14(18)10-17-15(19)9-16(2,3)4/h5,12-14H,1,6-11H2,2-4H3,(H,17,19)/t12-,13-,14+/m0/s1 |
| InChI Key | NNKRBQBOCNRMGN-MELADBBJSA-N |
| Canonical SMILES | CC(C)(C)CC(=O)NCC1CC2CCN1CC2C=C |
| CAS | |
| Splash | |
| Other Names |
Butanamide, N-[[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]oct-2-yl]methyl]-3,3-dimethyl-; NAT13-337457 |