Systematic / IUPAC Name: 1-[[(2R,4S,5S)-5-[[Methyl(prop-2-enyl)amino]methyl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3-[4-(trifluoromethoxy)phenyl]urea
ID: Reference9007
Other Names:
Urea, N-[[(2R,4S,5S)-5-[(methyl-2-propen-1-ylamino)methyl]-1-azabicyclo[2.2.2]oct-2-yl]methyl]-N'-[4-(trifluoromethoxy)phenyl]-;
NAT13-337724
Formula: C21H29F3N4O2
1-{[(2R,4S,5S)-5-{[Allyl(methyl)amino]methyl}-1-azabicyclo[2.2.2]oct-2-yl]methyl}-3-[4-(trifluoromethoxy)phenyl]urea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2376 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/21/2019 6:26:47 AM |
| InChI | InChI=1S/C21H29F3N4O2/c1-3-9-27(2)13-16-14-28-10-8-15(16)11-18(28)12-25-20(29)26-17-4-6-19(7-5-17)30-21(22,23)24/h3-7,15-16,18H,1,8-14H2,2H3,(H2,25,26,29)/t15-,16-,18+/m0/s1 |
| InChI Key | NTLZADYHRXAGTG-XYJFISCASA-N |
| Canonical SMILES | CN(CC=C)CC1CN2CCC1CC2CNC(=O)NC3=CC=C(C=C3)OC(F)(F)F |
| CAS | |
| Splash | |
| Other Names |
Urea, N-[[(2R,4S,5S)-5-[(methyl-2-propen-1-ylamino)methyl]-1-azabicyclo[2.2.2]oct-2-yl]methyl]-N'-[4-(trifluoromethoxy)phenyl]-; NAT13-337724 |