Systematic / IUPAC Name: 2-Methoxy-N-[[(2R,4S,5R)-5-(2-methyl-5-naphthalen-2-ylpyrazol-3-yl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]acetamide
ID: Reference9012
Other Names:
Acetamide, 2-methoxy-N-[[(2R,4S,5R)-5-[1-methyl-3-(2-naphthalenyl)-1H-pyrazol-5-yl]-1-azabicyclo[2.2.2]oct-2-yl]methyl]-;
NAT13-338083
Formula: C25H30N4O2
2-Methoxy-N-({(2R,4S,5R)-5-[1-methyl-3-(2-naphthyl)-1H-pyrazol-5-yl]-1-azabicyclo[2.2.2]oct-2-yl}methyl)acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2666 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/21/2019 6:45:51 AM |
| InChI | InChI=1S/C25H30N4O2/c1-28-24(13-23(27-28)20-8-7-17-5-3-4-6-18(17)11-20)22-15-29-10-9-19(22)12-21(29)14-26-25(30)16-31-2/h3-8,11,13,19,21-22H,9-10,12,14-16H2,1-2H3,(H,26,30)/t19-,21+,22-/m0/s1 |
| InChI Key | NGBQGXBVABXUSR-NNWRFLSQSA-N |
| Canonical SMILES | CN1C(=CC(=N1)C2=CC3=CC=CC=C3C=C2)C4CN5CCC4CC5CNC(=O)COC |
| CAS | |
| Splash | |
| Other Names |
Acetamide, 2-methoxy-N-[[(2R,4S,5R)-5-[1-methyl-3-(2-naphthalenyl)-1H-pyrazol-5-yl]-1-azabicyclo[2.2.2]oct-2-yl]methyl]-; NAT13-338083 |