Systematic / IUPAC Name: N-(1-Amino-1-oxo-3-thiophen-2-ylpropan-2-yl)-1-(2-methoxyacetyl)-4-[(2-methoxyacetyl)amino]piperidine-2-carboxamide
ID: Reference9018
Other Names:
2-Piperidinecarboxamide, N-[2-amino-2-oxo-1-(2-thienylmethyl)ethyl]-1-(2-methoxyacetyl)-4-[(2-methoxyacetyl)amino]-;
NAT7-262095
Formula: C19H28N4O6S
N-[1-Amino-1-oxo-3-(2-thienyl)-2-propanyl]-1-(methoxyacetyl)-4-[(methoxyacetyl)amino]-2-piperidinecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1230 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/17/2019 8:16:39 AM |
| InChI | InChI=1S/C19H28N4O6S/c1-28-10-16(24)21-12-5-6-23(17(25)11-29-2)15(8-12)19(27)22-14(18(20)26)9-13-4-3-7-30-13/h3-4,7,12,14-15H,5-6,8-11H2,1-2H3,(H2,20,26)(H,21,24)(H,22,27) |
| InChI Key | MBZBZFPTXQKRLJ-UHFFFAOYSA-N |
| Canonical SMILES | COCC(=O)NC1CCN(C(C1)C(=O)NC(CC2=CC=CS2)C(=O)N)C(=O)COC |
| CAS | |
| Splash | |
| Other Names |
2-Piperidinecarboxamide, N-[2-amino-2-oxo-1-(2-thienylmethyl)ethyl]-1-(2-methoxyacetyl)-4-[(2-methoxyacetyl)amino]-; NAT7-262095 |