Systematic / IUPAC Name: [(2R,4S,5R)-5-(2-Methyl-5-naphthalen-2-ylpyrazol-3-yl)-1-azabicyclo[2.2.2]octan-2-yl]methyl N-(4-methoxyphenyl)carbamate
ID: Reference9024
Other Names:
Carbamic acid, N-(4-methoxyphenyl)-, [(2R,4S,5R)-5-[1-methyl-3-(2-naphthalenyl)-1H-pyrazol-5-yl]-1-azabicyclo[2.2.2]oct-2-yl]methyl ester;
NAT13-338997
Formula: C30H32N4O3
{(2R,4S,5R)-5-[1-Methyl-3-(2-naphthyl)-1H-pyrazol-5-yl]-1-azabicyclo[2.2.2]oct-2-yl}methyl (4-methoxyphenyl)carbamate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1474 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/21/2019 6:52:38 AM |
| InChI | InChI=1S/C30H32N4O3/c1-33-29(17-28(32-33)23-8-7-20-5-3-4-6-21(20)15-23)27-18-34-14-13-22(27)16-25(34)19-37-30(35)31-24-9-11-26(36-2)12-10-24/h3-12,15,17,22,25,27H,13-14,16,18-19H2,1-2H3,(H,31,35)/t22-,25+,27-/m0/s1 |
| InChI Key | QOXNVGGSEZWCAT-RWUBSVTLSA-N |
| Canonical SMILES | CN1C(=CC(=N1)C2=CC3=CC=CC=C3C=C2)C4CN5CCC4CC5COC(=O)NC6=CC=C(C=C6)OC |
| CAS | |
| Splash | |
| Other Names |
Carbamic acid, N-(4-methoxyphenyl)-, [(2R,4S,5R)-5-[1-methyl-3-(2-naphthalenyl)-1H-pyrazol-5-yl]-1-azabicyclo[2.2.2]oct-2-yl]methyl ester; NAT13-338997 |