Systematic / IUPAC Name: N-[[(2R,4S,5S)-5-[[Benzyl(methyl)amino]methyl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]-4-(trifluoromethyl)benzamide
ID: Reference9037
Other Names:
Benzamide, N-[[(2R,4S,5S)-5-[[methyl(phenylmethyl)amino]methyl]-1-azabicyclo[2.2.2]oct-2-yl]methyl]-4-(trifluoromethyl)-;
NAT13-339340
Formula: C25H30F3N3O
N-{[(2R,4S,5S)-5-{[Benzyl(methyl)amino]methyl}-1-azabicyclo[2.2.2]oct-2-yl]methyl}-4-(trifluoromethyl)benzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1973 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/25/2019 11:33:48 AM |
| InChI | InChI=1S/C25H30F3N3O/c1-30(15-18-5-3-2-4-6-18)16-21-17-31-12-11-20(21)13-23(31)14-29-24(32)19-7-9-22(10-8-19)25(26,27)28/h2-10,20-21,23H,11-17H2,1H3,(H,29,32)/t20-,21-,23+/m0/s1 |
| InChI Key | QSXMLSSSNIGXBN-QNWVGRARSA-N |
| Canonical SMILES | CN(CC1CN2CCC1CC2CNC(=O)C3=CC=C(C=C3)C(F)(F)F)CC4=CC=CC=C4 |
| CAS | |
| Splash | |
| Other Names |
Benzamide, N-[[(2R,4S,5S)-5-[[methyl(phenylmethyl)amino]methyl]-1-azabicyclo[2.2.2]oct-2-yl]methyl]-4-(trifluoromethyl)-; NAT13-339340 |