Systematic / IUPAC Name: N-[[(2R,4S,5R)-5-(5-Cyclopentyl-2-methylpyrazol-3-yl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]methanesulfonamide
ID: Reference9048
Other Names:
Methanesulfonamide, N-[[(2R,4S,5R)-5-(3-cyclopentyl-1-methyl-1H-pyrazol-5-yl)-1-azabicyclo[2.2.2]oct-2-yl]methyl]-;
NAT13-334379
Formula: C18H30N4O2S
N-{[(2R,4S,5R)-5-(3-Cyclopentyl-1-methyl-1H-pyrazol-5-yl)-1-azabicyclo[2.2.2]oct-2-yl]methyl}methanesulfonamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 455 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/25/2019 7:25:39 AM |
| InChI | InChI=1S/C18H30N4O2S/c1-21-18(10-17(20-21)13-5-3-4-6-13)16-12-22-8-7-14(16)9-15(22)11-19-25(2,23)24/h10,13-16,19H,3-9,11-12H2,1-2H3/t14-,15+,16-/m0/s1 |
| InChI Key | OXISCWNJCVOSOZ-XHSDSOJGSA-N |
| Canonical SMILES | CN1C(=CC(=N1)C2CCCC2)C3CN4CCC3CC4CNS(=O)(=O)C |
| CAS | |
| Splash | |
| Other Names |
Methanesulfonamide, N-[[(2R,4S,5R)-5-(3-cyclopentyl-1-methyl-1H-pyrazol-5-yl)-1-azabicyclo[2.2.2]oct-2-yl]methyl]-; NAT13-334379 |