Systematic / IUPAC Name: [(2R,4S,5R)-5-[5-(3,4-Dimethoxyphenyl)-2-methylpyrazol-3-yl]-1-azabicyclo[2.2.2]octan-2-yl]methyl N-propan-2-ylcarbamate
ID: Reference9055
Other Names:
Carbamic acid, N-(1-methylethyl)-, [(2R,4S,5R)-5-[3-(3,4-dimethoxyphenyl)-1-methyl-1H-pyrazol-5-yl]-1-azabicyclo[2.2.2]oct-2-yl]methyl ester;
NAT13-339046
Formula: C24H34N4O4
{(2R,4S,5R)-5-[3-(3,4-Dimethoxyphenyl)-1-methyl-1H-pyrazol-5-yl]-1-azabicyclo[2.2.2]oct-2-yl}methyl isopropylcarbamate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 263 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/4/2019 10:57:39 AM |
| InChI | InChI=1S/C24H34N4O4/c1-15(2)25-24(29)32-14-18-10-16-8-9-28(18)13-19(16)21-12-20(26-27(21)3)17-6-7-22(30-4)23(11-17)31-5/h6-7,11-12,15-16,18-19H,8-10,13-14H2,1-5H3,(H,25,29)/t16-,18+,19-/m0/s1 |
| InChI Key | IUMDAWMYEIOCHJ-UHOSZYNNSA-N |
| Canonical SMILES | CC(C)NC(=O)OCC1CC2CCN1CC2C3=CC(=NN3C)C4=CC(=C(C=C4)OC)OC |
| CAS | |
| Splash | |
| Other Names |
Carbamic acid, N-(1-methylethyl)-, [(2R,4S,5R)-5-[3-(3,4-dimethoxyphenyl)-1-methyl-1H-pyrazol-5-yl]-1-azabicyclo[2.2.2]oct-2-yl]methyl ester; NAT13-339046 |