Systematic / IUPAC Name: [(2R,4S,5R)-5-(2-Methyl-5-thiophen-2-ylpyrazol-3-yl)-1-azabicyclo[2.2.2]octan-2-yl]methyl N-(4-acetylphenyl)carbamate
ID: Reference9056
Other Names:
Carbamic acid, N-(4-acetylphenyl)-, [(2R,4S,5R)-5-[1-methyl-3-(2-thienyl)-1H-pyrazol-5-yl]-1-azabicyclo[2.2.2]oct-2-yl]methyl ester;
NAT13-331661
Formula: C25H28N4O3S
{(2R,4S,5R)-5-[1-Methyl-3-(2-thienyl)-1H-pyrazol-5-yl]-1-azabicyclo[2.2.2]oct-2-yl}methyl (4-acetylphenyl)carbamate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1292 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/4/2019 11:00:08 AM |
| InChI | InChI=1S/C25H28N4O3S/c1-16(30)17-5-7-19(8-6-17)26-25(31)32-15-20-12-18-9-10-29(20)14-21(18)23-13-22(27-28(23)2)24-4-3-11-33-24/h3-8,11,13,18,20-21H,9-10,12,14-15H2,1-2H3,(H,26,31)/t18-,20+,21-/m0/s1 |
| InChI Key | SORMOEXKGRUZCP-TYPHKJRUSA-N |
| Canonical SMILES | CC(=O)C1=CC=C(C=C1)NC(=O)OCC2CC3CCN2CC3C4=CC(=NN4C)C5=CC=CS5 |
| CAS | |
| Splash | |
| Other Names |
Carbamic acid, N-(4-acetylphenyl)-, [(2R,4S,5R)-5-[1-methyl-3-(2-thienyl)-1H-pyrazol-5-yl]-1-azabicyclo[2.2.2]oct-2-yl]methyl ester; NAT13-331661 |