Systematic / IUPAC Name: 1-(3-Cyanophenyl)-3-[[(2R,4S,5R)-5-(5-cyclohexyl-2-methylpyrazol-3-yl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]urea
ID: Reference9058
Other Names:
Urea, N-(3-cyanophenyl)-N'-[[(2R,4S,5R)-5-(3-cyclohexyl-1-methyl-1H-pyrazol-5-yl)-1-azabicyclo[2.2.2]oct-2-yl]methyl]-;
NAT13-333682
Formula: C26H34N6O
1-(3-Cyanophenyl)-3-{[(2R,4S,5R)-5-(3-cyclohexyl-1-methyl-1H-pyrazol-5-yl)-1-azabicyclo[2.2.2]oct-2-yl]methyl}urea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2290 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/4/2019 11:09:14 AM |
| InChI | InChI=1S/C26H34N6O/c1-31-25(14-24(30-31)19-7-3-2-4-8-19)23-17-32-11-10-20(23)13-22(32)16-28-26(33)29-21-9-5-6-18(12-21)15-27/h5-6,9,12,14,19-20,22-23H,2-4,7-8,10-11,13,16-17H2,1H3,(H2,28,29,33)/t20-,22+,23-/m0/s1 |
| InChI Key | UTXNBBGSQOOZMT-WWNPGLIZSA-N |
| Canonical SMILES | CN1C(=CC(=N1)C2CCCCC2)C3CN4CCC3CC4CNC(=O)NC5=CC=CC(=C5)C#N |
| CAS | |
| Splash | |
| Other Names |
Urea, N-(3-cyanophenyl)-N'-[[(2R,4S,5R)-5-(3-cyclohexyl-1-methyl-1H-pyrazol-5-yl)-1-azabicyclo[2.2.2]oct-2-yl]methyl]-; NAT13-333682 |