Systematic / IUPAC Name: [(2R,4S,5R)-5-(2-Methyl-5-naphthalen-2-ylpyrazol-3-yl)-1-azabicyclo[2.2.2]octan-2-yl]methyl N-propan-2-ylcarbamate
ID: Reference9059
Other Names:
Carbamic acid, N-(1-methylethyl)-, [(2R,4S,5R)-5-[1-methyl-3-(2-naphthalenyl)-1H-pyrazol-5-yl]-1-azabicyclo[2.2.2]oct-2-yl]methyl ester;
NAT13-338989
Formula: C26H32N4O2
{(2R,4S,5R)-5-[1-Methyl-3-(2-naphthyl)-1H-pyrazol-5-yl]-1-azabicyclo[2.2.2]oct-2-yl}methyl isopropylcarbamate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2256 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/4/2019 11:13:41 AM |
| InChI | InChI=1S/C26H32N4O2/c1-17(2)27-26(31)32-16-22-13-20-10-11-30(22)15-23(20)25-14-24(28-29(25)3)21-9-8-18-6-4-5-7-19(18)12-21/h4-9,12,14,17,20,22-23H,10-11,13,15-16H2,1-3H3,(H,27,31)/t20-,22+,23-/m0/s1 |
| InChI Key | OQSSSYBBHWTCCN-WWNPGLIZSA-N |
| Canonical SMILES | CC(C)NC(=O)OCC1CC2CCN1CC2C3=CC(=NN3C)C4=CC5=CC=CC=C5C=C4 |
| CAS | |
| Splash | |
| Other Names |
Carbamic acid, N-(1-methylethyl)-, [(2R,4S,5R)-5-[1-methyl-3-(2-naphthalenyl)-1H-pyrazol-5-yl]-1-azabicyclo[2.2.2]oct-2-yl]methyl ester; NAT13-338989 |