Systematic / IUPAC Name: N-[[(2R,4S,5R)-5-(2-Methyl-5-phenylpyrazol-3-yl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]methanesulfonamide
ID: Reference9069
Other Names:
Methanesulfonamide, N-[[(2R,4S,5R)-5-(1-methyl-3-phenyl-1H-pyrazol-5-yl)-1-azabicyclo[2.2.2]oct-2-yl]methyl]-;
NAT13-332219
Formula: C19H26N4O2S
N-{[(2R,4S,5R)-5-(1-Methyl-3-phenyl-1H-pyrazol-5-yl)-1-azabicyclo[2.2.2]oct-2-yl]methyl}methanesulfonamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 464 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/4/2019 11:36:02 AM |
| InChI | InChI=1S/C19H26N4O2S/c1-22-19(11-18(21-22)14-6-4-3-5-7-14)17-13-23-9-8-15(17)10-16(23)12-20-26(2,24)25/h3-7,11,15-17,20H,8-10,12-13H2,1-2H3/t15-,16+,17-/m0/s1 |
| InChI Key | FMBQBWCUWJDZFQ-BBWFWOEESA-N |
| Canonical SMILES | CN1C(=CC(=N1)C2=CC=CC=C2)C3CN4CCC3CC4CNS(=O)(=O)C |
| CAS | |
| Splash | |
| Other Names |
Methanesulfonamide, N-[[(2R,4S,5R)-5-(1-methyl-3-phenyl-1H-pyrazol-5-yl)-1-azabicyclo[2.2.2]oct-2-yl]methyl]-; NAT13-332219 |
| ChEMBL | CHEMBL3437432 |
| PubChem | 40779189 |
| ChemSpider | 21380788 |