Systematic / IUPAC Name: N-[[(2R,4S,5R)-5-(5-Cyclopentyl-2-methylpyrazol-3-yl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]furan-2-carboxamide
ID: Reference9073
Other Names:
2-Furancarboxamide, N-[[(2R,4S,5R)-5-(3-cyclopentyl-1-methyl-1H-pyrazol-5-yl)-1-azabicyclo[2.2.2]oct-2-yl]methyl]-;
NAT13-334359
Formula: C22H30N4O2
N-{[(2R,4S,5R)-5-(3-Cyclopentyl-1-methyl-1H-pyrazol-5-yl)-1-azabicyclo[2.2.2]oct-2-yl]methyl}-2-furamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1412 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/4/2019 12:27:28 PM |
| InChI | InChI=1S/C22H30N4O2/c1-25-20(12-19(24-25)15-5-2-3-6-15)18-14-26-9-8-16(18)11-17(26)13-23-22(27)21-7-4-10-28-21/h4,7,10,12,15-18H,2-3,5-6,8-9,11,13-14H2,1H3,(H,23,27)/t16-,17+,18-/m0/s1 |
| InChI Key | FABJAUUGNRAJRD-KSZLIROESA-N |
| Canonical SMILES | CN1C(=CC(=N1)C2CCCC2)C3CN4CCC3CC4CNC(=O)C5=CC=CO5 |
| CAS | |
| Splash | |
| Other Names |
2-Furancarboxamide, N-[[(2R,4S,5R)-5-(3-cyclopentyl-1-methyl-1H-pyrazol-5-yl)-1-azabicyclo[2.2.2]oct-2-yl]methyl]-; NAT13-334359 |