Systematic / IUPAC Name: 1-(3-Cyanophenyl)-3-[[(2R,4S,5S)-5-[(4-phenylpiperazin-1-yl)methyl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]urea
ID: Reference9081
Other Names:
Urea, N-(3-cyanophenyl)-N'-[[(2R,4S,5S)-5-[(4-phenyl-1-piperazinyl)methyl]-1-azabicyclo[2.2.2]oct-2-yl]methyl]-;
NAT13-339652
Formula: C27H34N6O
1-(3-Cyanophenyl)-3-({(2R,4S,5S)-5-[(4-phenyl-1-piperazinyl)methyl]-1-azabicyclo[2.2.2]oct-2-yl}methyl)urea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1849 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/6/2019 11:26:10 AM |
| InChI | InChI=1S/C27H34N6O/c28-17-21-5-4-6-24(15-21)30-27(34)29-18-26-16-22-9-10-33(26)20-23(22)19-31-11-13-32(14-12-31)25-7-2-1-3-8-25/h1-8,15,22-23,26H,9-14,16,18-20H2,(H2,29,30,34)/t22-,23-,26+/m0/s1 |
| InChI Key | DHSCNZPZIUFJEW-JCYRPKCISA-N |
| Canonical SMILES | C1CN2CC(C1CC2CNC(=O)NC3=CC=CC(=C3)C#N)CN4CCN(CC4)C5=CC=CC=C5 |
| CAS | |
| Splash | |
| Other Names |
Urea, N-(3-cyanophenyl)-N'-[[(2R,4S,5S)-5-[(4-phenyl-1-piperazinyl)methyl]-1-azabicyclo[2.2.2]oct-2-yl]methyl]-; NAT13-339652 |