Systematic / IUPAC Name: 4-(Dimethylamino)-N-[[(2R,4S,5S)-5-[[2-(dimethylamino)ethyl-methylamino]methyl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]benzamide
ID: Reference9088
Other Names:
Benzamide, 4-(dimethylamino)-N-[[(2R,4S,5S)-5-[[[2-(dimethylamino)ethyl]methylamino]methyl]-1-azabicyclo[2.2.2]oct-2-yl]methyl]-;
NAT13-339392
Formula: C23H39N5O
4-(Dimethylamino)-N-{[(2R,4S,5S)-5-({[2-(dimethylamino)ethyl](methyl)amino}methyl)-1-azabicyclo[2.2.2]oct-2-yl]methyl}benzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1065 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/7/2019 8:07:43 AM |
| InChI | InChI=1S/C23H39N5O/c1-25(2)12-13-27(5)16-20-17-28-11-10-19(20)14-22(28)15-24-23(29)18-6-8-21(9-7-18)26(3)4/h6-9,19-20,22H,10-17H2,1-5H3,(H,24,29)/t19-,20-,22+/m0/s1 |
| InChI Key | IUSLSVPTTKWMFZ-JAXLGGSGSA-N |
| Canonical SMILES | CN(C)CCN(C)CC1CN2CCC1CC2CNC(=O)C3=CC=C(C=C3)N(C)C |
| CAS | |
| Splash | |
| Other Names |
Benzamide, 4-(dimethylamino)-N-[[(2R,4S,5S)-5-[[[2-(dimethylamino)ethyl]methylamino]methyl]-1-azabicyclo[2.2.2]oct-2-yl]methyl]-; NAT13-339392 |