Systematic / IUPAC Name: N-[[(2R,4S,5R)-5-[(N-Methylanilino)methyl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]thiophene-2-sulfonamide
ID: Reference9093
Other Names:
2-Thiophenesulfonamide, N-[[(2R,4S,5R)-5-[(methylphenylamino)methyl]-1-azabicyclo[2.2.2]oct-2-yl]methyl]-;
NAT13-339795
Formula: C20H27N3O2S2
N-{[(2R,4S,5R)-5-{[Methyl(phenyl)amino]methyl}-1-azabicyclo[2.2.2]oct-2-yl]methyl}-2-thiophenesulfonamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1095 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/7/2019 8:13:24 AM |
| InChI | InChI=1S/C20H27N3O2S2/c1-22(18-6-3-2-4-7-18)14-17-15-23-10-9-16(17)12-19(23)13-21-27(24,25)20-8-5-11-26-20/h2-8,11,16-17,19,21H,9-10,12-15H2,1H3/t16-,17-,19+/m0/s1 |
| InChI Key | CDGOERLIBLLKCC-JENIJYKNSA-N |
| Canonical SMILES | CN(CC1CN2CCC1CC2CNS(=O)(=O)C3=CC=CS3)C4=CC=CC=C4 |
| CAS | |
| Splash | |
| Other Names |
2-Thiophenesulfonamide, N-[[(2R,4S,5R)-5-[(methylphenylamino)methyl]-1-azabicyclo[2.2.2]oct-2-yl]methyl]-; NAT13-339795 |