Systematic / IUPAC Name: N-[[(2R,4S,5R)-5-Ethyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]thiophene-2-sulfonamide
ID: Reference9104
Other Names:
2-Thiophenesulfonamide, N-[[(2R,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]oct-2-yl]methyl]-;
NAT13-337382
Formula: C14H22N2O2S2
N-{[(2R,4S,5R)-5-Ethyl-1-azabicyclo[2.2.2]oct-2-yl]methyl}-2-thiophenesulfonamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 378 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/13/2019 1:32:34 PM |
| InChI | InChI=1S/C14H22N2O2S2/c1-2-11-10-16-6-5-12(11)8-13(16)9-15-20(17,18)14-4-3-7-19-14/h3-4,7,11-13,15H,2,5-6,8-10H2,1H3/t11-,12-,13+/m0/s1 |
| InChI Key | LFYFJKVSXVECHL-RWMBFGLXSA-N |
| Canonical SMILES | CCC1CN2CCC1CC2CNS(=O)(=O)C3=CC=CS3 |
| CAS | |
| Splash | |
| Other Names |
2-Thiophenesulfonamide, N-[[(2R,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]oct-2-yl]methyl]-; NAT13-337382 |