Systematic / IUPAC Name: Methyl (2R,4S,6S,12bR)-2-(2-acetamidoethylamino)-4-(2-fluorophenyl)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine-6-carboxylate
ID: Reference9108
Other Names:
Indolo[2,3-a]quinolizine-6-carboxylic acid, 2-[[2-(acetylamino)ethyl]amino]-4-(2-fluorophenyl)-1,2,3,4,6,7,12,12b-octahydro-, methyl ester, (2R,4S,6S,12bR)-;
NAT15-330851
Formula: C27H31FN4O3
Methyl (2R,4S,6S,12bR)-2-[(2-acetamidoethyl)amino]-4-(2-fluorophenyl)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine-6-carboxylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 3285 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/13/2019 1:41:12 PM |
| InChI | InChI=1S/C27H31FN4O3/c1-16(33)29-11-12-30-17-13-23(19-8-3-5-9-21(19)28)32-24(14-17)26-20(15-25(32)27(34)35-2)18-7-4-6-10-22(18)31-26/h3-10,17,23-25,30-31H,11-15H2,1-2H3,(H,29,33)/t17-,23+,24-,25+/m1/s1 |
| InChI Key | MGXYTULNMXEFNW-LIWHFGNWSA-N |
| Canonical SMILES | CC(=O)NCCNC1CC(N2C(C1)C3=C(CC2C(=O)OC)C4=CC=CC=C4N3)C5=CC=CC=C5F |
| CAS | |
| Splash | |
| Other Names |
Indolo[2,3-a]quinolizine-6-carboxylic acid, 2-[[2-(acetylamino)ethyl]amino]-4-(2-fluorophenyl)-1,2,3,4,6,7,12,12b-octahydro-, methyl ester, (2R,4S,6S,12bR)-; NAT15-330851 |