Systematic / IUPAC Name: 2-[[(3S,3aR,6R,6aS)-3-[[4-(4-Methoxyphenyl)pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-N,N-dimethylacetamide
ID: Reference9131
Other Names:
D-Glucitol, 1,4:3,6-dianhydro-2-deoxy-5-O-[2-(dimethylamino)-2-oxoethyl]-2-[[4-(4-methoxyphenyl)-2-pyrimidinyl]amino]-;
NAT6-318853
Formula: C21H26N4O5
1,4:3,6-Dianhydro-2-deoxy-5-O-[2-(dimethylamino)-2-oxoethyl]-2-{[4-(4-methoxyphenyl)-2-pyrimidinyl]amino}-D-glucitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 5439 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6, MS7 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/22/2019 11:52:14 AM |
| InChI | InChI=1S/C21H26N4O5/c1-25(2)18(26)12-28-17-11-30-19-16(10-29-20(17)19)24-21-22-9-8-15(23-21)13-4-6-14(27-3)7-5-13/h4-9,16-17,19-20H,10-12H2,1-3H3,(H,22,23,24)/t16-,17+,19+,20+/m0/s1 |
| InChI Key | ORNKKRXKCNJYAG-ONCXSQPRSA-N |
| Canonical SMILES | CN(C)C(=O)COC1COC2C1OCC2NC3=NC=CC(=N3)C4=CC=C(C=C4)OC |
| CAS | |
| Splash | |
| Other Names |
D-Glucitol, 1,4:3,6-dianhydro-2-deoxy-5-O-[2-(dimethylamino)-2-oxoethyl]-2-[[4-(4-methoxyphenyl)-2-pyrimidinyl]amino]-; NAT6-318853 |