Systematic / IUPAC Name: [(2R,4S,5R)-5-[6-(4-Methoxyphenyl)-2-methylpyrimidin-4-yl]-1-azabicyclo[2.2.2]octan-2-yl]methyl N-(4-acetylphenyl)carbamate
ID: Reference9151
Other Names:
Carbamic acid, N-(4-acetylphenyl)-, [(2R,4S,5R)-5-[6-(4-methoxyphenyl)-2-methyl-4-pyrimidinyl]-1-azabicyclo[2.2.2]oct-2-yl]methyl ester;
NAT13-339990
Formula: C29H32N4O4
{(2R,4S,5R)-5-[6-(4-Methoxyphenyl)-2-methyl-4-pyrimidinyl]-1-azabicyclo[2.2.2]oct-2-yl}methyl (4-acetylphenyl)carbamate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2458 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/25/2019 7:00:44 AM |
| InChI | InChI=1S/C29H32N4O4/c1-18(34)20-4-8-23(9-5-20)32-29(35)37-17-24-14-22-12-13-33(24)16-26(22)28-15-27(30-19(2)31-28)21-6-10-25(36-3)11-7-21/h4-11,15,22,24,26H,12-14,16-17H2,1-3H3,(H,32,35)/t22-,24+,26-/m0/s1 |
| InChI Key | IGVFERQHIOCLMV-FBILRYNDSA-N |
| Canonical SMILES | CC1=NC(=CC(=N1)C2CN3CCC2CC3COC(=O)NC4=CC=C(C=C4)C(=O)C)C5=CC=C(C=C5)OC |
| CAS | |
| Splash | |
| Other Names |
Carbamic acid, N-(4-acetylphenyl)-, [(2R,4S,5R)-5-[6-(4-methoxyphenyl)-2-methyl-4-pyrimidinyl]-1-azabicyclo[2.2.2]oct-2-yl]methyl ester; NAT13-339990 |