Systematic / IUPAC Name: 4-(3,4-Dichlorophenyl)-N-methyl-1,2,3,4-tetrahydro-1-naphthalenamine
ID: Reference917
Other Names:
(1S,4S)-4-(3,4-Dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine;
(1S-cis)-1,2,3,4-Tetrahydro-4-(3,4-dichlorophenyl)-N-methyl-1-naphthalenamine;
1-Naphthalenamine, 1,2,3,4-tetrahydro-4-(3,4-dichlorophenyl)-N-methyl-, (1S-cis-)-;
Zoloft;
(+)-Sertraline
; more
Formula: C17H17Cl2N
Class: Therapeutics/Prescription Drugs
Sertraline mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 169 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/30/2015 12:09:14 PM |
| InChI | InChI=1S/C17H17Cl2N/c1-20-17-9-7-12(13-4-2-3-5-14(13)17)11-6-8-15(18)16(19)10-11/h2-6,8,10,12,17,20H,7,9H2,1H3/t12-,17-/m0/s1 |
| InChI Key | VGKDLMBJGBXTGI-SJCJKPOMSA-N |
| Canonical SMILES | CNC1CCC(C2=CC=CC=C12)C3=CC(=C(C=C3)Cl)Cl |
| CAS | 79617962 |
| Splash | |
| Other Names |
(1S,4S)-4-(3,4-Dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine; (1S-cis)-1,2,3,4-Tetrahydro-4-(3,4-dichlorophenyl)-N-methyl-1-naphthalenamine; 1-Naphthalenamine, 1,2,3,4-tetrahydro-4-(3,4-dichlorophenyl)-N-methyl-, (1S-cis-)-; Zoloft; (+)-Sertraline; cis-(+)-Sertraline; (1S,4S)-Sertraline |
| ChemIDPlus | 079617962 |
| ChemSpider | 61881 |
| ChEBI | CHEBI:9123 |
| ChEMBL | CHEMBL809 |
| Wikipedia | Sertraline |
| PubChem | 68617 |
| KEGG | C07246; D02360 |
| DrugBank | APRD00175 |
| HMDb | HMDB05010 |