Systematic / IUPAC Name: 6-chloro-N2,N4-diethyl-1,3,5-triazine-2,4-diamine
ID: Reference92
Other Names:
2,4-Bis(ethylamino)-6-chloro-s-triazine;
2-Chloro-4,6-bis(ethylamino)-s-triazine;
s-Triazine, 2-chloro-4,6-bis(ethylamino)-;
2-Chloro-4,6-bis(ethylamino)-1,3,5-triazine;
6-Chloro-N2,N4-diethyl-1,3,5-triazine-2,4-diamine
; more
Formula: C7H12ClN5
Class: Pesticides/Herbicides
Simazine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL; Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 5 |
| No. of Spectra | 1143 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; APCI; NSI |
| Analyzers | FT |
| Last Modification | 2/10/2015 2:06:29 PM |
| InChI | InChI=1S/C7H12ClN5/c1-3-9-6-11-5(8)12-7(13-6)10-4-2/h3-4H2,1-2H3,(H2,9,10,11,12,13) |
| InChI Key | ODCWYMIRDDJXKW-UHFFFAOYSA-N |
| Canonical SMILES | CCNC1=NC(=NC(=N1)Cl)NCC |
| CAS | 122349 |
| Splash | |
| Other Names |
2,4-Bis(ethylamino)-6-chloro-s-triazine; 2-Chloro-4,6-bis(ethylamino)-s-triazine; s-Triazine, 2-chloro-4,6-bis(ethylamino)-; 2-Chloro-4,6-bis(ethylamino)-1,3,5-triazine; 6-Chloro-N2,N4-diethyl-1,3,5-triazine-2,4-diamine; 2,4-Bis(ethylamino)-6-chloro-1,3,5-triazine; 1-Chloro-3,5-bis(ethylamino)-2,4,6-triazine; Chloro-4,6-bis( ethylamino)-s-triazine; [4-Chloro-6-(ethylamino)(1,3,5-triazin-2-yl)]ethylamine; 6-Chloro-N,N'-diethyl-1,3,5-triazine-2,4-diamine; Gesatop; Princep; Simanex; Herbazin 50; Aquazine; Batazina; Herbazin; Symazine; Tafazine; Taphazine; Amizine; Bitemol; Gesapun; Herbex; Herboxy; Printop; Radocon; Radokor; Simadex; Zeapur; Primatol S; Aktinit S; Hungazin DT; Tafazine 50-W; Gesaran; Premazine; Simazin; Cekuzina-S; Primatel; Cat; Cekusima; Yrodazin; Simatsin-neste; Herbatoxol S; Batazine FLO; Herbex; Tafazine; Permazine; Printrex; Framed; Cekusan gesatop; Princep 4G; Princep 4L; Aquazine 90WDG; Caliber 90; Gesatop-50; Princep 80W; Sim-trol 4L; Bitemol S-50; Princep caliber 90; Simazat; Azotop |
| ChEMBL | CHEMBL1605837 |
| KEGG | C11172 |
| ChemSpider | 5027 |
| ChemIDPlus | 000122349; 053126753; 037287539; 063821863 |
| ChEBI | CHEBI:27496 |
| PubChem | 5216 |
| Wikipedia | Simazine |