Systematic / IUPAC Name: 1-[(1S,4S)-4-(1-Benzyl-3,5-dimethylpyrazol-4-yl)cyclopent-2-en-1-yl]-3-phenylurea
ID: Reference9202
Other Names:
Urea, N-[(1S,4S)-4-[3,5-dimethyl-1-(phenylmethyl)-1H-pyrazol-4-yl]-2-cyclopenten-1-yl]-N'-phenyl-;
NAT16-353253
Formula: C24H26N4O
1-[(1S,4S)-4-(1-Benzyl-3,5-dimethyl-1H-pyrazol-4-yl)-2-cyclopenten-1-yl]-3-phenylurea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1464 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/5/2019 7:33:57 AM |
| InChI | InChI=1S/C24H26N4O/c1-17-23(18(2)28(27-17)16-19-9-5-3-6-10-19)20-13-14-22(15-20)26-24(29)25-21-11-7-4-8-12-21/h3-14,20,22H,15-16H2,1-2H3,(H2,25,26,29)/t20-,22-/m1/s1 |
| InChI Key | INAQSKVWBFBLCJ-IFMALSPDSA-N |
| Canonical SMILES | CC1=C(C(=NN1CC2=CC=CC=C2)C)C3CC(C=C3)NC(=O)NC4=CC=CC=C4 |
| CAS | |
| Splash | |
| Other Names |
Urea, N-[(1S,4S)-4-[3,5-dimethyl-1-(phenylmethyl)-1H-pyrazol-4-yl]-2-cyclopenten-1-yl]-N'-phenyl-; NAT16-353253 |