Systematic / IUPAC Name: 5-[[(1S,4S)-4-[3,5-Dimethyl-1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]cyclopent-2-en-1-yl]amino]-5-oxopentanoic acid
ID: Reference9248
Other Names:
Pentanoic acid, 5-[[(1S,4S)-4-[3,5-dimethyl-1-[4-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl]-2-cyclopenten-1-yl]amino]-5-oxo-;
NAT16-368437
Formula: C22H24F3N3O3
5-{[(1S,4S)-4-{3,5-Dimethyl-1-[4-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl}-2-cyclopenten-1-yl]amino}-5-oxopentanoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 3112 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/10/2020 1:39:43 PM |
| InChI | InChI=1S/C22H24F3N3O3/c1-13-21(15-6-9-17(12-15)26-19(29)4-3-5-20(30)31)14(2)28(27-13)18-10-7-16(8-11-18)22(23,24)25/h6-11,15,17H,3-5,12H2,1-2H3,(H,26,29)(H,30,31)/t15-,17-/m1/s1 |
| InChI Key | YWAANJNCLUQGBY-NVXWUHKLSA-N |
| Canonical SMILES | CC1=C(C(=NN1C2=CC=C(C=C2)C(F)(F)F)C)C3CC(C=C3)NC(=O)CCCC(=O)O |
| CAS | |
| Splash | |
| Other Names |
Pentanoic acid, 5-[[(1S,4S)-4-[3,5-dimethyl-1-[4-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl]-2-cyclopenten-1-yl]amino]-5-oxo-; NAT16-368437 |