Systematic / IUPAC Name: 1-[[(2R,4S,5R)-5-[6-(2-Bromophenyl)-2-methylpyrimidin-4-yl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3-phenylurea
ID: Reference9259
Other Names:
Urea, N-[[(2R,4S,5R)-5-[6-(2-bromophenyl)-2-methyl-4-pyrimidinyl]-1-azabicyclo[2.2.2]oct-2-yl]methyl]-N'-phenyl-;
NAT13-368689
Formula: C26H28BrN5O
1-({(2R,4S,5R)-5-[6-(2-Bromophenyl)-2-methyl-4-pyrimidinyl]-1-azabicyclo[2.2.2]oct-2-yl}methyl)-3-phenylurea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1033 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/10/2020 1:51:22 PM |
| InChI | InChI=1S/C26H28BrN5O/c1-17-29-24(21-9-5-6-10-23(21)27)14-25(30-17)22-16-32-12-11-18(22)13-20(32)15-28-26(33)31-19-7-3-2-4-8-19/h2-10,14,18,20,22H,11-13,15-16H2,1H3,(H2,28,31,33)/t18-,20+,22-/m0/s1 |
| InChI Key | DDXHPWZWDPDBQL-DWLFOUALSA-N |
| Canonical SMILES | CC1=NC(=CC(=N1)C2CN3CCC2CC3CNC(=O)NC4=CC=CC=C4)C5=CC=CC=C5Br |
| CAS | |
| Splash | |
| Other Names |
Urea, N-[[(2R,4S,5R)-5-[6-(2-bromophenyl)-2-methyl-4-pyrimidinyl]-1-azabicyclo[2.2.2]oct-2-yl]methyl]-N'-phenyl-; NAT13-368689 |