Systematic / IUPAC Name: 1-[(1S,4S)-4-[3,5-Dimethyl-1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]cyclopent-2-en-1-yl]-3-propan-2-ylurea
ID: Reference9270
Other Names:
Urea, N-[(1S,4S)-4-[3,5-dimethyl-1-[4-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl]-2-cyclopenten-1-yl]-N'-(1-methylethyl)-;
NAT16-368415
Formula: C21H25F3N4O
1-[(1S,4S)-4-{3,5-Dimethyl-1-[4-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl}-2-cyclopenten-1-yl]-3-isopropylurea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1630 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/14/2020 9:54:35 AM |
| InChI | InChI=1S/C21H25F3N4O/c1-12(2)25-20(29)26-17-8-5-15(11-17)19-13(3)27-28(14(19)4)18-9-6-16(7-10-18)21(22,23)24/h5-10,12,15,17H,11H2,1-4H3,(H2,25,26,29)/t15-,17-/m1/s1 |
| InChI Key | HJBNFDZDXDFEMG-NVXWUHKLSA-N |
| Canonical SMILES | CC1=C(C(=NN1C2=CC=C(C=C2)C(F)(F)F)C)C3CC(C=C3)NC(=O)NC(C)C |
| CAS | |
| Splash | |
| Other Names |
Urea, N-[(1S,4S)-4-[3,5-dimethyl-1-[4-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl]-2-cyclopenten-1-yl]-N'-(1-methylethyl)-; NAT16-368415 |