Systematic / IUPAC Name: N-[[(2R,4S,5R)-5-[6-(2-Bromophenyl)-2-methylpyrimidin-4-yl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]furan-2-carboxamide
ID: Reference9273
Other Names:
2-Furancarboxamide, N-[[(2R,4S,5R)-5-[6-(2-bromophenyl)-2-methyl-4-pyrimidinyl]-1-azabicyclo[2.2.2]oct-2-yl]methyl]-;
NAT13-368654
Formula: C24H25BrN4O2
N-({(2R,4S,5R)-5-[6-(2-Bromophenyl)-2-methyl-4-pyrimidinyl]-1-azabicyclo[2.2.2]oct-2-yl}methyl)-2-furamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 523 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/14/2020 10:39:39 AM |
| InChI | InChI=1S/C24H25BrN4O2/c1-15-27-21(18-5-2-3-6-20(18)25)12-22(28-15)19-14-29-9-8-16(19)11-17(29)13-26-24(30)23-7-4-10-31-23/h2-7,10,12,16-17,19H,8-9,11,13-14H2,1H3,(H,26,30)/t16-,17+,19-/m0/s1 |
| InChI Key | ABIFPJQIAXMRMB-SCTDSRPQSA-N |
| Canonical SMILES | CC1=NC(=CC(=N1)C2CN3CCC2CC3CNC(=O)C4=CC=CO4)C5=CC=CC=C5Br |
| CAS | |
| Splash | |
| Other Names |
2-Furancarboxamide, N-[[(2R,4S,5R)-5-[6-(2-bromophenyl)-2-methyl-4-pyrimidinyl]-1-azabicyclo[2.2.2]oct-2-yl]methyl]-; NAT13-368654 |