Systematic / IUPAC Name: N-[(1S,4S)-4-[3,5-Dimethyl-1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]cyclopent-2-en-1-yl]thiophene-2-carboxamide
ID: Reference9276
Other Names:
2-Thiophenecarboxamide, N-[(1S,4S)-4-[3,5-dimethyl-1-[4-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl]-2-cyclopenten-1-yl]-;
NAT16-368435
Formula: C22H20F3N3OS
N-[(1S,4S)-4-{3,5-Dimethyl-1-[4-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl}-2-cyclopenten-1-yl]-2-thiophenecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 3398 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/14/2020 10:44:58 AM |
| InChI | InChI=1S/C22H20F3N3OS/c1-13-20(15-5-8-17(12-15)26-21(29)19-4-3-11-30-19)14(2)28(27-13)18-9-6-16(7-10-18)22(23,24)25/h3-11,15,17H,12H2,1-2H3,(H,26,29)/t15-,17-/m1/s1 |
| InChI Key | JQBKVUNSNCNFPX-NVXWUHKLSA-N |
| Canonical SMILES | CC1=C(C(=NN1C2=CC=C(C=C2)C(F)(F)F)C)C3CC(C=C3)NC(=O)C4=CC=CS4 |
| CAS | |
| Splash | |
| Other Names |
2-Thiophenecarboxamide, N-[(1S,4S)-4-[3,5-dimethyl-1-[4-(trifluoromethyl)phenyl]-1H-pyrazol-4-yl]-2-cyclopenten-1-yl]-; NAT16-368435 |