Systematic / IUPAC Name: 1-[(3S,3aR,6R,6aS)-6-Phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-5-(4-phenylphenyl)tetrazole
ID: Reference9297
Other Names:
D-Glucitol, 1,4:3,6-dianhydro-2-(5-[1,1'-biphenyl]-4-yl-1H-tetrazol-1-yl)-2-deoxy-5-O-(phenylmethyl)-;
NAT6-296431
Formula: C26H24N4O3
1,4:3,6-Dianhydro-5-O-benzyl-2-[5-(4-biphenylyl)-1H-tetrazol-1-yl]-2-deoxy-D-glucitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 654 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/24/2020 9:35:18 AM |
| InChI | InChI=1S/C26H24N4O3/c1-3-7-18(8-4-1)15-31-23-17-33-24-22(16-32-25(23)24)30-26(27-28-29-30)21-13-11-20(12-14-21)19-9-5-2-6-10-19/h1-14,22-25H,15-17H2/t22-,23+,24+,25+/m0/s1 |
| InChI Key | BILQEWVBQGSBDW-ZYQDXHPFSA-N |
| Canonical SMILES | C1C(C2C(O1)C(CO2)OCC3=CC=CC=C3)N4C(=NN=N4)C5=CC=C(C=C5)C6=CC=CC=C6 |
| CAS | |
| Splash | |
| Other Names |
D-Glucitol, 1,4:3,6-dianhydro-2-(5-[1,1'-biphenyl]-4-yl-1H-tetrazol-1-yl)-2-deoxy-5-O-(phenylmethyl)-; NAT6-296431 |