Systematic / IUPAC Name: 1-Benzyl-3-[[(2R,4S,5R)-5-[6-(4-fluorophenyl)-2-methylpyrimidin-4-yl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]urea
ID: Reference9317
Other Names:
Urea, N-[[(2R,4S,5R)-5-[6-(4-fluorophenyl)-2-methyl-4-pyrimidinyl]-1-azabicyclo[2.2.2]oct-2-yl]methyl]-N'-(phenylmethyl)-;
NAT13-341061
Formula: C27H30FN5O
1-Benzyl-3-({(2R,4S,5R)-5-[6-(4-fluorophenyl)-2-methyl-4-pyrimidinyl]-1-azabicyclo[2.2.2]oct-2-yl}methyl)urea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1363 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/24/2020 11:40:54 AM |
| InChI | InChI=1S/C27H30FN5O/c1-18-31-25(20-7-9-22(28)10-8-20)14-26(32-18)24-17-33-12-11-21(24)13-23(33)16-30-27(34)29-15-19-5-3-2-4-6-19/h2-10,14,21,23-24H,11-13,15-17H2,1H3,(H2,29,30,34)/t21-,23+,24-/m0/s1 |
| InChI Key | HSGNNUVRGZPADZ-QTJGBDASSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names |
Urea, N-[[(2R,4S,5R)-5-[6-(4-fluorophenyl)-2-methyl-4-pyrimidinyl]-1-azabicyclo[2.2.2]oct-2-yl]methyl]-N'-(phenylmethyl)-; NAT13-341061 |