Systematic / IUPAC Name: [(2R,4S,5S)-5-Ethynyl-1-azabicyclo[2.2.2]octan-2-yl]methyl N-(2,4-difluorophenyl)carbamate
ID: Reference9324
Other Names:
Carbamic acid, N-(2,4-difluorophenyl)-, [(2R,4S,5S)-5-ethynyl-1-azabicyclo[2.2.2]oct-2-yl]methyl ester;
NAT13-337333
Formula: C17H18F2N2O2
[(2R,4S,5S)-5-Ethynyl-1-azabicyclo[2.2.2]oct-2-yl]methyl (2,4-difluorophenyl)carbamate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 559 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/24/2020 11:54:57 AM |
| InChI | InChI=1S/C17H18F2N2O2/c1-2-11-9-21-6-5-12(11)7-14(21)10-23-17(22)20-16-4-3-13(18)8-15(16)19/h1,3-4,8,11-12,14H,5-7,9-10H2,(H,20,22)/t11-,12-,14+/m0/s1 |
| InChI Key | FMJCWTMXZWLIEP-SGMGOOAPSA-N |
| Canonical SMILES | C#CC1CN2CCC1CC2COC(=O)NC3=C(C=C(C=C3)F)F |
| CAS | |
| Splash | |
| Other Names |
Carbamic acid, N-(2,4-difluorophenyl)-, [(2R,4S,5S)-5-ethynyl-1-azabicyclo[2.2.2]oct-2-yl]methyl ester; NAT13-337333 |