Systematic / IUPAC Name: 1-Ethyl-3-[[(2R,4S,5R)-5-(2-methyl-6-phenylpyrimidin-4-yl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]urea
ID: Reference9332
Other Names:
Urea, N-ethyl-N'-[[(2R,4S,5R)-5-(2-methyl-6-phenyl-4-pyrimidinyl)-1-azabicyclo[2.2.2]oct-2-yl]methyl]-;
NAT13-342491
Formula: C22H29N5O
1-Ethyl-3-{[(2R,4S,5R)-5-(2-methyl-6-phenyl-4-pyrimidinyl)-1-azabicyclo[2.2.2]oct-2-yl]methyl}urea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 229 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/3/2020 8:34:58 AM |
| InChI | InChI=1S/C22H29N5O/c1-3-23-22(28)24-13-18-11-17-9-10-27(18)14-19(17)21-12-20(25-15(2)26-21)16-7-5-4-6-8-16/h4-8,12,17-19H,3,9-11,13-14H2,1-2H3,(H2,23,24,28)/t17-,18+,19-/m0/s1 |
| InChI Key | WZTFHBMZNXGYSO-OTWHNJEPSA-N |
| Canonical SMILES | CCNC(=O)NCC1CC2CCN1CC2C3=NC(=NC(=C3)C4=CC=CC=C4)C |
| CAS | |
| Splash | |
| Other Names |
Urea, N-ethyl-N'-[[(2R,4S,5R)-5-(2-methyl-6-phenyl-4-pyrimidinyl)-1-azabicyclo[2.2.2]oct-2-yl]methyl]-; NAT13-342491 |