Systematic / IUPAC Name: N-[[(2R,4S,5R)-5-(2-Methyl-6-thiophen-2-ylpyrimidin-4-yl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]cyclobutanecarboxamide
ID: Reference9334
Other Names:
Cyclobutanecarboxamide, N-[[(2R,4S,5R)-5-[2-methyl-6-(2-thienyl)-4-pyrimidinyl]-1-azabicyclo[2.2.2]oct-2-yl]methyl]-;
NAT13-342697
Formula: C22H28N4OS
N-({(2R,4S,5R)-5-[2-Methyl-6-(2-thienyl)-4-pyrimidinyl]-1-azabicyclo[2.2.2]oct-2-yl}methyl)cyclobutanecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2306 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/3/2020 8:40:26 AM |
| InChI | InChI=1S/C22H28N4OS/c1-14-24-19(11-20(25-14)21-6-3-9-28-21)18-13-26-8-7-16(18)10-17(26)12-23-22(27)15-4-2-5-15/h3,6,9,11,15-18H,2,4-5,7-8,10,12-13H2,1H3,(H,23,27)/t16-,17+,18-/m0/s1 |
| InChI Key | JUTGXTWSPQZEAA-KSZLIROESA-N |
| Canonical SMILES | CC1=NC(=CC(=N1)C2CN3CCC2CC3CNC(=O)C4CCC4)C5=CC=CS5 |
| CAS | |
| Splash | |
| Other Names |
Cyclobutanecarboxamide, N-[[(2R,4S,5R)-5-[2-methyl-6-(2-thienyl)-4-pyrimidinyl]-1-azabicyclo[2.2.2]oct-2-yl]methyl]-; NAT13-342697 |