Systematic / IUPAC Name: Methyl 2-[[(3S,3aR,6R,6aS)-3-[[3-(trifluoromethyl)phenyl]carbamoylamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]acetate
ID: Reference9353
Other Names:
D-Glucitol, 1,4:3,6-dianhydro-2-deoxy-5-O-(2-methoxy-2-oxoethyl)-2-[[[[3-(trifluoromethyl)phenyl]amino]carbonyl]amino]-;
NAT6-269175
Formula: C17H19F3N2O6
1,4:3,6-Dianhydro-2-deoxy-5-O-(2-methoxy-2-oxoethyl)-2-({[3-(trifluoromethyl)phenyl]carbamoyl}amino)-D-glucitol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 4919 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/5/2020 2:21:49 PM |
| InChI | InChI=1S/C17H19F3N2O6/c1-25-13(23)8-26-12-7-28-14-11(6-27-15(12)14)22-16(24)21-10-4-2-3-9(5-10)17(18,19)20/h2-5,11-12,14-15H,6-8H2,1H3,(H2,21,22,24)/t11-,12+,14+,15+/m0/s1 |
| InChI Key | VCXWXIGACZJSBA-CTHBEMJXSA-N |
| Canonical SMILES | COC(=O)COC1COC2C1OCC2NC(=O)NC3=CC=CC(=C3)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names |
D-Glucitol, 1,4:3,6-dianhydro-2-deoxy-5-O-(2-methoxy-2-oxoethyl)-2-[[[[3-(trifluoromethyl)phenyl]amino]carbonyl]amino]-; NAT6-269175 |