Systematic / IUPAC Name: (4aR)-9-(4-Chlorophenyl)-3-(3-fluorobenzoyl)-2,4,4a,6-tetrahydro-1H-pyrazino[2,1-c][1,4]benzodiazepine-5,11-dione
ID: Reference9355
Other Names:
Pyrazino[2,1-c][1,4]benzodiazepine-6,12(2H,11H)-dione, 8-(4-chlorophenyl)-2-(3-fluorobenzoyl)-1,3,4,12a-tetrahydro-, (12aR)-;
NAT9-273014
Formula: C25H19ClFN3O3
(12aR)-8-(4-Chlorophenyl)-2-(3-fluorobenzoyl)-1,3,4,12a-tetrahydropyrazino[2,1-c][1,4]benzodiazepine-6,12(2H,11H)-dione mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2419 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 2/5/2020 2:24:30 PM |
| InChI | InChI=1S/C25H19ClFN3O3/c26-18-7-4-15(5-8-18)16-6-9-21-20(13-16)25(33)30-11-10-29(14-22(30)23(31)28-21)24(32)17-2-1-3-19(27)12-17/h1-9,12-13,22H,10-11,14H2,(H,28,31)/t22-/m1/s1 |
| InChI Key | TYDAKCKOARWBAX-JOCHJYFZSA-N |
| Canonical SMILES | C1CN2C(CN1C(=O)C3=CC(=CC=C3)F)C(=O)NC4=C(C2=O)C=C(C=C4)C5=CC=C(C=C5)Cl |
| CAS | |
| Splash | |
| Other Names |
Pyrazino[2,1-c][1,4]benzodiazepine-6,12(2H,11H)-dione, 8-(4-chlorophenyl)-2-(3-fluorobenzoyl)-1,3,4,12a-tetrahydro-, (12aR)-; NAT9-273014 |