Systematic / IUPAC Name: 4-Hydroxy-3-(3-oxo-1-phenylbutyl)-2H-chromen-2-one
ID: Reference937
Other Names:
2H-1-Benzopyran-2-one, 4-hydroxy-3-(3-oxo-1-phenylbutyl)-;
4-Hydroxy-3-(3-oxo-1-phenylbutyl)-2H-1-benzopyran-2-one;
(Phenyl-1 acetyl-2 ethyl) 3-hydroxy-4 coumarine;
3-(α-Phenyl-β-acetylethyl)-4-hydroxycoumarin;
Coumarin, 3-(α-acetonylbenzyl)-4-hydroxy-
; more
Formula: C19H16O4
Class: Therapeutics/Prescription Drugs Pesticides/Herbicides
Warfarin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 9 |
| No. of Spectra | 759 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | ESI; APCI |
| Analyzers | FT |
| Last Modification | 4/1/2015 11:29:08 AM |
| InChI | InChI=1S/C19H16O4/c1-12(20)11-15(13-7-3-2-4-8-13)17-18(21)14-9-5-6-10-16(14)23-19(17)22/h2-10,15,21H,11H2,1H3 |
| InChI Key | PJVWKTKQMONHTI-UHFFFAOYSA-N |
| Canonical SMILES | CC(=O)CC(C1=CC=CC=C1)C2=C(C3=CC=CC=C3OC2=O)O |
| CAS | 81812 |
| Splash | |
| Other Names |
2H-1-Benzopyran-2-one, 4-hydroxy-3-(3-oxo-1-phenylbutyl)-; 4-Hydroxy-3-(3-oxo-1-phenylbutyl)-2H-1-benzopyran-2-one; (Phenyl-1 acetyl-2 ethyl) 3-hydroxy-4 coumarine; 3-(α-Phenyl-β-acetylethyl)-4-hydroxycoumarin; Coumarin, 3-(α-acetonylbenzyl)-4-hydroxy-; 2-Hydroxy-3-(3-oxo-1-phenyl-butyl)chromen-4-one; 3-(Acetonylbenzyl)-4-hydroxycoumarin; 3-(α-Acetonylbenzyl)-4-hydroxycoumarin; (Phenyl-1 acetyl-2 ethyl) 3-hydroxy-4 coumarin; Coumafene; Coumadin; Prothromadin; Coumafen; Zoocoumarin; Brumolin; Coumefene; Kypfarin; Panwarfin; Solfarin; Dethmor; Dethnel; Kumader; Kumadu; Maveran; Rosex; Athrombine-K; Vampirinip II; Mar-frin; Temus W; Coumaphene; Rattentraenke; Kumatox; Ratorex; Rattunal; Rodafarin; Warfarat; Ratron; D-Con; Rats-no-more; Tox-hid; Rat-gard; Rat-kill; Rat-trol; Rat-a-way; Rat-mix; Ratoxin; Warfarin +; Ratron G; Coumaphen; Warficide; Ratox; Waran; Athrombin-K; Warf 10; Rax; Warfant; Sakarat; Sewarin |
| ChEBI | CHEBI:10033 |
| ChemSpider | 10442445; 21234283 |
| PubChem | 54678486 |
| KEGG | C01541; D08682 |
| ChEMBL | CHEMBL1464 |
| Wikipedia | Warfarin |