Systematic / IUPAC Name: (6S)-6-N-[(4-Chlorophenyl)methyl]-5-N-cyclohexyl-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5,6-dicarboxamide
ID: Reference9442
Other Names:
5H-Imidazo[4,5-c]pyridine-5,6-dicarboxamide, N6-[(4-chlorophenyl)methyl]-N5-cyclohexyl-1,4,6,7-tetrahydro-, (6S)-;
NAT22-371093
Formula: C21H26ClN5O2
(6S)-N6-(4-chlorobenzyl)-N5-cyclohexyl-1,4,6,7-tetrahydro-5H-imidazo[4,5-c]pyridine-5,6-dicarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2041 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/5/2020 12:23:25 PM |
| InChI | InChI=1S/C21H26ClN5O2/c22-15-8-6-14(7-9-15)11-23-20(28)19-10-17-18(25-13-24-17)12-27(19)21(29)26-16-4-2-1-3-5-16/h6-9,13,16,19H,1-5,10-12H2,(H,23,28)(H,24,25)(H,26,29)/t19-/m0/s1 |
| InChI Key | LGNSYNGBBQDGRB-IBGZPJMESA-N |
| Canonical SMILES | C1CCC(CC1)NC(=O)N2CC3=C(CC2C(=O)NCC4=CC=C(C=C4)Cl)N=CN3 |
| CAS | |
| Splash | |
| Other Names |
5H-Imidazo[4,5-c]pyridine-5,6-dicarboxamide, N6-[(4-chlorophenyl)methyl]-N5-cyclohexyl-1,4,6,7-tetrahydro-, (6S)-; NAT22-371093 |